C21H22ClNO4S — CID 56645611
5-(4-chlorophenyl)-3-[(3R)-3-cyclohexyl-5-oxomorpholin-4-yl]thiophene-2-carboxylic acid (PubChem CID 56645611) has the molecular formula C21H22ClNO4S and a molecular weight of 419.93 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(3R)-3-cyclohexyl-5-oxomorpholin-4-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-(4-chlorophenyl)-3-[(3R)-3-cyclohexyl-5-oxomorpholin-4-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 56645611 |
| Molecular Formula | C21H22ClNO4S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(3R)-3-cyclohexyl-5-oxomorpholin-4-yl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccc(Cl)cc2)cc1N1C(=O)COC[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C21H22ClNO4S/c22-15-8-6-14(7-9-15)18-10-16(20(28-18)21(25)26)23-17(11-27-12-19(23)24)13-4-2-1-3-5-13/h6-10,13,17H,1-5,11-12H2,(H,25,26)/t17-/m0/s1 |
| InChIKey | UXJQYJDJFCUSFZ-KRWDZBQOSA-N |
| XLogP | 5.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |