C26H33NO3S — CID 67208630
5-(4-tert-butylphenyl)-3-(2-cyclohexyl-6-oxopiperidin-1-yl)thiophene-2-carboxylic acid (PubChem CID 67208630) has the molecular formula C26H33NO3S and a molecular weight of 439.62 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-3-(2-cyclohexyl-6-oxopiperidin-1-yl)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-tert-butylphenyl)-3-(2-cyclohexyl-6-oxopiperidin-1-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67208630 |
| Molecular Formula | C26H33NO3S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 5-(4-tert-butylphenyl)-3-(2-cyclohexyl-6-oxopiperidin-1-yl)thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(-c2cc(N3C(=O)CCCC3C3CCCCC3)c(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C26H33NO3S/c1-26(2,3)19-14-12-18(13-15-19)22-16-21(24(31-22)25(29)30)27-20(10-7-11-23(27)28)17-8-5-4-6-9-17/h12-17,20H,4-11H2,1-3H3,(H,29,30) |
| InChIKey | SWTLDDFGHOQISB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |