C19H28N2O3S — CID 67208735
5-tert-butyl-3-(2-cyclohexyl-6-oxopiperazin-1-yl)thiophene-2-carboxylic acid (PubChem CID 67208735) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 5-tert-butyl-3-(2-cyclohexyl-6-oxopiperazin-1-yl)thiophene-2-carboxylic acid.
| Compound Name | 5-tert-butyl-3-(2-cyclohexyl-6-oxopiperazin-1-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67208735 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 5-tert-butyl-3-(2-cyclohexyl-6-oxopiperazin-1-yl)thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)c1cc(N2C(=O)CNCC2C2CCCCC2)c(C(=O)O)s1 |
| InChI | InChI=1S/C19H28N2O3S/c1-19(2,3)15-9-13(17(25-15)18(23)24)21-14(10-20-11-16(21)22)12-7-5-4-6-8-12/h9,12,14,20H,4-8,10-11H2,1-3H3,(H,23,24) |
| InChIKey | OIUWLKDGMHJZPF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |