C25H36N2O5S — CID 56645811
3-[(2R)-5-cyclohexyl-2-[(2-methoxyethylamino)methyl]-3-oxomorpholin-4-yl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid (PubChem CID 56645811) has the molecular formula C25H36N2O5S and a molecular weight of 476.64 g/mol. Its IUPAC name is 3-[(2R)-5-cyclohexyl-2-[(2-methoxyethylamino)methyl]-3-oxomorpholin-4-yl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[(2R)-5-cyclohexyl-2-[(2-methoxyethylamino)methyl]-3-oxomorpholin-4-yl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 56645811 |
| Molecular Formula | C25H36N2O5S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 3-[(2R)-5-cyclohexyl-2-[(2-methoxyethylamino)methyl]-3-oxomorpholin-4-yl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
| SMILES | COCCNC[C@H]1OCC(C2CCCCC2)N(c2cc(C#CC(C)(C)C)sc2C(=O)O)C1=O |
| InChI | InChI=1S/C25H36N2O5S/c1-25(2,3)11-10-18-14-19(22(33-18)24(29)30)27-20(17-8-6-5-7-9-17)16-32-21(23(27)28)15-26-12-13-31-4/h14,17,20-21,26H,5-9,12-13,15-16H2,1-4H3,(H,29,30)/t20?,21-/m1/s1 |
| InChIKey | BWMBXYCFRQVALM-BPGUCPLFSA-N |
| XLogP | 3.76 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|