C22H28N4O3S — CID 150476811
3-[(3S)-3-azido-6-cyclohexyl-2-oxopiperidin-1-yl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid (PubChem CID 150476811) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 3-[(3S)-3-azido-6-cyclohexyl-2-oxopiperidin-1-yl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[(3S)-3-azido-6-cyclohexyl-2-oxopiperidin-1-yl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 150476811 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-[(3S)-3-azido-6-cyclohexyl-2-oxopiperidin-1-yl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)C#Cc1cc(N2C(=O)[C@@H](N=[N+]=[N-])CCC2C2CCCCC2)c(C(=O)O)s1 |
| InChI | InChI=1S/C22H28N4O3S/c1-22(2,3)12-11-15-13-18(19(30-15)21(28)29)26-17(14-7-5-4-6-8-14)10-9-16(20(26)27)24-25-23/h13-14,16-17H,4-10H2,1-3H3,(H,28,29)/t16-,17?/m0/s1 |
| InChIKey | HSYYCHMQYYCSSV-BHWOMJMDSA-N |
| XLogP | 5.60 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|