C27H27FN2O3S2 — CID 87310424
3-[2-cyclohexyl-4-(2-fluorophenyl)sulfanyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid (PubChem CID 87310424) has the molecular formula C27H27FN2O3S2 and a molecular weight of 510.66 g/mol. Its IUPAC name is 3-[2-cyclohexyl-4-(2-fluorophenyl)sulfanyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[2-cyclohexyl-4-(2-fluorophenyl)sulfanyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 87310424 |
| Molecular Formula | C27H27FN2O3S2 |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 3-[2-cyclohexyl-4-(2-fluorophenyl)sulfanyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccccc2)cc1N1C(=O)CN(Sc2ccccc2F)CC1C1CCCCC1 |
| InChI | InChI=1S/C27H27FN2O3S2/c28-20-13-7-8-14-23(20)35-29-16-22(18-9-3-1-4-10-18)30(25(31)17-29)21-15-24(34-26(21)27(32)33)19-11-5-2-6-12-19/h2,5-8,11-15,18,22H,1,3-4,9-10,16-17H2,(H,32,33) |
| InChIKey | OTYOPALKTMYFDT-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|