C11H18N6O — CID 672103
4-(ethylamino)-6-piperidin-1-yl-1,3,5-triazine-2-carboxamide (PubChem CID 672103) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is 4-(ethylamino)-6-piperidin-1-yl-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-(ethylamino)-6-piperidin-1-yl-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 672103 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-(ethylamino)-6-piperidin-1-yl-1,3,5-triazine-2-carboxamide |
| SMILES | CCNc1nc(C(N)=O)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C11H18N6O/c1-2-13-10-14-9(8(12)18)15-11(16-10)17-6-4-3-5-7-17/h2-7H2,1H3,(H2,12,18)(H,13,14,15,16) |
| InChIKey | LVMNJJPCIXAJJW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |