C9H12O — CID 67212236
1-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene (PubChem CID 67212236) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 1-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene.
| Compound Name | 1-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene |
|---|---|
| PubChem CID | 67212236 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 1-ethyl-3-oxatricyclo[3.2.1.02,4]oct-2(4)-ene |
| SMILES | CCC12CCC(C1)C1=C2O1 |
| InChI | InChI=1S/C9H12O/c1-2-9-4-3-6(5-9)7-8(9)10-7/h6H,2-5H2,1H3 |
| InChIKey | VNAAPDMYRRJLRJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |