C28H29F3N2O2Si — CID 67212387
N-benzyl-N-[[2-[2-methoxy-5-(2-trimethylsilylethynyl)-3-pyridinyl]-5-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 67212387) has the molecular formula C28H29F3N2O2Si and a molecular weight of 510.63 g/mol. Its IUPAC name is N-benzyl-N-[[2-[2-methoxy-5-(2-trimethylsilylethynyl)-3-pyridinyl]-5-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | N-benzyl-N-[[2-[2-methoxy-5-(2-trimethylsilylethynyl)-3-pyridinyl]-5-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 67212387 |
| Molecular Formula | C28H29F3N2O2Si |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | N-benzyl-N-[[2-[2-methoxy-5-(2-trimethylsilylethynyl)-3-pyridinyl]-5-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | COc1ncc(C#C[Si](C)(C)C)cc1-c1ccc(C(F)(F)F)cc1CN(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C28H29F3N2O2Si/c1-20(34)33(18-21-9-7-6-8-10-21)19-23-16-24(28(29,30)31)11-12-25(23)26-15-22(13-14-36(3,4)5)17-32-27(26)35-2/h6-12,15-17H,18-19H2,1-5H3 |
| InChIKey | FTMJURWLDPFQMV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|