C19H21NO7 — CID 67214546
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-6-(2-hydroxybenzoyl)oxyhexanoic acid (PubChem CID 67214546) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-6-(2-hydroxybenzoyl)oxyhexanoic acid.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-6-(2-hydroxybenzoyl)oxyhexanoic acid |
|---|---|
| PubChem CID | 67214546 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-6-(2-hydroxybenzoyl)oxyhexanoic acid |
| SMILES | N[C@H](C(=O)O)C(CCCOC(=O)c1ccccc1O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H21NO7/c20-17(18(24)25)12(11-7-8-15(22)16(23)10-11)5-3-9-27-19(26)13-4-1-2-6-14(13)21/h1-2,4,6-8,10,12,17,21-23H,3,5,9,20H2,(H,24,25)/t12?,17-/m0/s1 |
| InChIKey | DDWHYKPXUXIBPJ-TYJDENFWSA-N |
| XLogP | 1.94 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|