C19H22ClNO7 — CID 67213899
(2S,5R)-2-amino-3-(3,4-dihydroxyphenyl)-5-(4-hydroxybenzoyl)oxyhexanoic acid;hydrochloride (PubChem CID 67213899) has the molecular formula C19H22ClNO7 and a molecular weight of 411.84 g/mol. Its IUPAC name is (2S,5R)-2-amino-3-(3,4-dihydroxyphenyl)-5-(4-hydroxybenzoyl)oxyhexanoic acid;hydrochloride.
| Compound Name | (2S,5R)-2-amino-3-(3,4-dihydroxyphenyl)-5-(4-hydroxybenzoyl)oxyhexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67213899 |
| Molecular Formula | C19H22ClNO7 |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (2S,5R)-2-amino-3-(3,4-dihydroxyphenyl)-5-(4-hydroxybenzoyl)oxyhexanoic acid;hydrochloride |
| SMILES | C[C@H](CC(c1ccc(O)c(O)c1)[C@H](N)C(=O)O)OC(=O)c1ccc(O)cc1.Cl |
| InChI | InChI=1S/C19H21NO7.ClH/c1-10(27-19(26)11-2-5-13(21)6-3-11)8-14(17(20)18(24)25)12-4-7-15(22)16(23)9-12;/h2-7,9-10,14,17,21-23H,8,20H2,1H3,(H,24,25);1H/t10-,14?,17+;/m1./s1 |
| InChIKey | YPBVVOJNQBJOKC-GBNGTQASSA-N |
| XLogP | 2.36 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|