C20H22FNO6 — CID 67214291
(2S,4S,5S)-2-amino-3-(3,4-dihydroxyphenyl)-5-(4-fluorobenzoyl)oxy-4-methylhexanoic acid (PubChem CID 67214291) has the molecular formula C20H22FNO6 and a molecular weight of 391.40 g/mol. Its IUPAC name is (2S,4S,5S)-2-amino-3-(3,4-dihydroxyphenyl)-5-(4-fluorobenzoyl)oxy-4-methylhexanoic acid.
| Compound Name | (2S,4S,5S)-2-amino-3-(3,4-dihydroxyphenyl)-5-(4-fluorobenzoyl)oxy-4-methylhexanoic acid |
|---|---|
| PubChem CID | 67214291 |
| Molecular Formula | C20H22FNO6 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2S,4S,5S)-2-amino-3-(3,4-dihydroxyphenyl)-5-(4-fluorobenzoyl)oxy-4-methylhexanoic acid |
| SMILES | C[C@H](OC(=O)c1ccc(F)cc1)[C@@H](C)C(c1ccc(O)c(O)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C20H22FNO6/c1-10(11(2)28-20(27)12-3-6-14(21)7-4-12)17(18(22)19(25)26)13-5-8-15(23)16(24)9-13/h3-11,17-18,23-24H,22H2,1-2H3,(H,25,26)/t10-,11+,17?,18+/m1/s1 |
| InChIKey | IVZGRJCBWAHCIY-CCRVYVJUSA-N |
| XLogP | 2.61 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|