C17H26BrNO — CID 67215099
1-[2-(2-bromophenoxy)ethyl]-2,2,3,3-tetramethylpiperidine (PubChem CID 67215099) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is 1-[2-(2-bromophenoxy)ethyl]-2,2,3,3-tetramethylpiperidine.
| Compound Name | 1-[2-(2-bromophenoxy)ethyl]-2,2,3,3-tetramethylpiperidine |
|---|---|
| PubChem CID | 67215099 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[2-(2-bromophenoxy)ethyl]-2,2,3,3-tetramethylpiperidine |
| SMILES | CC1(C)CCCN(CCOc2ccccc2Br)C1(C)C |
| InChI | InChI=1S/C17H26BrNO/c1-16(2)10-7-11-19(17(16,3)4)12-13-20-15-9-6-5-8-14(15)18/h5-6,8-9H,7,10-13H2,1-4H3 |
| InChIKey | JDGCTWKPNCYJRW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |