C14H18BrNO — CID 91216513
(2R,5R)-1-[2-(2-bromophenoxy)ethyl]-2,5-dimethyl-2,5-dihydropyrrole (PubChem CID 91216513) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is (2R,5R)-1-[2-(2-bromophenoxy)ethyl]-2,5-dimethyl-2,5-dihydropyrrole.
| Compound Name | (2R,5R)-1-[2-(2-bromophenoxy)ethyl]-2,5-dimethyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 91216513 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (2R,5R)-1-[2-(2-bromophenoxy)ethyl]-2,5-dimethyl-2,5-dihydropyrrole |
| SMILES | C[C@@H]1C=C[C@@H](C)N1CCOc1ccccc1Br |
| InChI | InChI=1S/C14H18BrNO/c1-11-7-8-12(2)16(11)9-10-17-14-6-4-3-5-13(14)15/h3-8,11-12H,9-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | XAWFCQJIRICNOT-VXGBXAGGSA-N |
| XLogP | 3.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|