C21H22F5N3O2 — CID 67216228
1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-2-[(7-fluoro-1H-pyrrolo[2,3-c]pyridin-2-yl)methylamino]-4-methylpentan-2-ol (PubChem CID 67216228) has the molecular formula C21H22F5N3O2 and a molecular weight of 443.42 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-2-[(7-fluoro-1H-pyrrolo[2,3-c]pyridin-2-yl)methylamino]-4-methylpentan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-2-[(7-fluoro-1H-pyrrolo[2,3-c]pyridin-2-yl)methylamino]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 67216228 |
| Molecular Formula | C21H22F5N3O2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-2-[(7-fluoro-1H-pyrrolo[2,3-c]pyridin-2-yl)methylamino]-4-methylpentan-2-ol |
| SMILES | COc1ccc(F)cc1C(C)(C)CC(O)(NCc1cc2ccnc(F)c2[nH]1)C(F)(F)F |
| InChI | InChI=1S/C21H22F5N3O2/c1-19(2,15-9-13(22)4-5-16(15)31-3)11-20(30,21(24,25)26)28-10-14-8-12-6-7-27-18(23)17(12)29-14/h4-9,28-30H,10-11H2,1-3H3 |
| InChIKey | YJCLLTVDUQDHDR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|