About 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene
1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene (PubChem CID 67217973) has the molecular formula C10H9BrF2O
and a molecular weight of 263.08 g/mol. Its IUPAC name is 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene.
Molecular Properties
| Compound Name | 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene |
| PubChem CID | 67217973 |
| Molecular Formula | C10H9BrF2O |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene |
| SMILES | Fc1cccc(OC/C=C/CBr)c1F |
| InChI | InChI=1S/C10H9BrF2O/c11-6-1-2-7-14-9-5-3-4-8(12)10(9)13/h1-5H,6-7H2/b2-1+ |
| InChIKey | GQALQSQPOQXLGV-OWOJBTEDSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene?
The IUPAC name of 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene (CID 67217973) is 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene.
What is the SMILES notation for 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene?
The canonical SMILES for 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene is Fc1cccc(OC/C=C/CBr)c1F.
What is the InChIKey of 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene?
The InChIKey is GQALQSQPOQXLGV-OWOJBTEDSA-N. The full InChI is InChI=1S/C10H9BrF2O/c11-6-1-2-7-14-9-5-3-4-8(12)10(9)13/h1-5H,6-7H2/b2-1+.
What are the key properties of 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene?
1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene has a molecular weight of 263.08 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-4-bromobut-2-enoxy]-2,3-difluorobenzene is sourced from PubChem (CID 67217973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).