C35H36N2O4 — CID 67224777
bis(2-butylphenyl) 6H-benzo[d][1,3]benzodiazepine-5,7-dicarboxylate (PubChem CID 67224777) has the molecular formula C35H36N2O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is bis(2-butylphenyl) 6H-benzo[d][1,3]benzodiazepine-5,7-dicarboxylate.
| Compound Name | bis(2-butylphenyl) 6H-benzo[d][1,3]benzodiazepine-5,7-dicarboxylate |
|---|---|
| PubChem CID | 67224777 |
| Molecular Formula | C35H36N2O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | bis(2-butylphenyl) 6H-benzo[d][1,3]benzodiazepine-5,7-dicarboxylate |
| SMILES | CCCCc1ccccc1OC(=O)N1CN(C(=O)Oc2ccccc2CCCC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H36N2O4/c1-3-5-15-26-17-7-13-23-32(26)40-34(38)36-25-37(35(39)41-33-24-14-8-18-27(33)16-6-4-2)31-22-12-10-20-29(31)28-19-9-11-21-30(28)36/h7-14,17-24H,3-6,15-16,25H2,1-2H3 |
| InChIKey | NWHGMWQWAMUUNH-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |