C15H20N2O4S — CID 67227237
3-cyano-4-[(4-hydroxy-4-methylcyclohexyl)methoxy]benzenesulfonamide (PubChem CID 67227237) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 3-cyano-4-[(4-hydroxy-4-methylcyclohexyl)methoxy]benzenesulfonamide.
| Compound Name | 3-cyano-4-[(4-hydroxy-4-methylcyclohexyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 67227237 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-cyano-4-[(4-hydroxy-4-methylcyclohexyl)methoxy]benzenesulfonamide |
| SMILES | CC1(O)CCC(COc2ccc(S(N)(=O)=O)cc2C#N)CC1 |
| InChI | InChI=1S/C15H20N2O4S/c1-15(18)6-4-11(5-7-15)10-21-14-3-2-13(22(17,19)20)8-12(14)9-16/h2-3,8,11,18H,4-7,10H2,1H3,(H2,17,19,20) |
| InChIKey | QZNAPFZNKAGPCB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |