C18H26N2O7S — CID 67126715
4-[(3,3-dimethyl-2,4-dioxaspiro[5.5]undecan-9-yl)methoxy]-3-nitrobenzenesulfonamide (PubChem CID 67126715) has the molecular formula C18H26N2O7S and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-[(3,3-dimethyl-2,4-dioxaspiro[5.5]undecan-9-yl)methoxy]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(3,3-dimethyl-2,4-dioxaspiro[5.5]undecan-9-yl)methoxy]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67126715 |
| Molecular Formula | C18H26N2O7S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-[(3,3-dimethyl-2,4-dioxaspiro[5.5]undecan-9-yl)methoxy]-3-nitrobenzenesulfonamide |
| SMILES | CC1(C)OCC2(CCC(COc3ccc(S(N)(=O)=O)cc3[N+](=O)[O-])CC2)CO1 |
| InChI | InChI=1S/C18H26N2O7S/c1-17(2)26-11-18(12-27-17)7-5-13(6-8-18)10-25-16-4-3-14(28(19,23)24)9-15(16)20(21)22/h3-4,9,13H,5-8,10-12H2,1-2H3,(H2,19,23,24) |
| InChIKey | VORGYPQCCTTWHO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|