C16H25NOS — CID 67232691
[4-(3,3-dimethylbutyl)piperidin-4-yl]-thiophen-3-ylmethanone (PubChem CID 67232691) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is [4-(3,3-dimethylbutyl)piperidin-4-yl]-thiophen-3-ylmethanone.
| Compound Name | [4-(3,3-dimethylbutyl)piperidin-4-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 67232691 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | [4-(3,3-dimethylbutyl)piperidin-4-yl]-thiophen-3-ylmethanone |
| SMILES | CC(C)(C)CCC1(C(=O)c2ccsc2)CCNCC1 |
| InChI | InChI=1S/C16H25NOS/c1-15(2,3)5-6-16(7-9-17-10-8-16)14(18)13-4-11-19-12-13/h4,11-12,17H,5-10H2,1-3H3 |
| InChIKey | XYVZLOWYEIWACG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |