About methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride
methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride (PubChem CID 67233076) has the molecular formula C13H18ClN3O2
and a molecular weight of 283.76 g/mol. Its IUPAC name is methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride |
| PubChem CID | 67233076 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cnccc1N1C2CCC1CNC2.Cl |
| InChI | InChI=1S/C13H17N3O2.ClH/c1-18-13(17)11-8-14-5-4-12(11)16-9-2-3-10(16)7-15-6-9;/h4-5,8-10,15H,2-3,6-7H2,1H3;1H |
| InChIKey | FJOGAMXABBHNRJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride?
The IUPAC name of methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride (CID 67233076) is methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride.
What is the SMILES notation for methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride?
The canonical SMILES for methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride is COC(=O)c1cnccc1N1C2CCC1CNC2.Cl.
What is the InChIKey of methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride?
The InChIKey is FJOGAMXABBHNRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2.ClH/c1-18-13(17)11-8-14-5-4-12(11)16-9-2-3-10(16)7-15-6-9;/h4-5,8-10,15H,2-3,6-7H2,1H3;1H.
What are the key properties of methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride?
methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride has a molecular weight of 283.76 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,8-diazabicyclo[3.2.1]octan-8-yl)pyridine-3-carboxylate;hydrochloride is sourced from PubChem (CID 67233076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).