C28H33FO3S — CID 67236447
2-[3-(5-fluorothiophen-2-yl)-4-(5-phenylpentoxy)phenyl]-4,4,5,5-tetramethyl-1,3-dioxolane (PubChem CID 67236447) has the molecular formula C28H33FO3S and a molecular weight of 468.63 g/mol. Its IUPAC name is 2-[3-(5-fluorothiophen-2-yl)-4-(5-phenylpentoxy)phenyl]-4,4,5,5-tetramethyl-1,3-dioxolane.
| Compound Name | 2-[3-(5-fluorothiophen-2-yl)-4-(5-phenylpentoxy)phenyl]-4,4,5,5-tetramethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 67236447 |
| Molecular Formula | C28H33FO3S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2-[3-(5-fluorothiophen-2-yl)-4-(5-phenylpentoxy)phenyl]-4,4,5,5-tetramethyl-1,3-dioxolane |
| SMILES | CC1(C)OC(c2ccc(OCCCCCc3ccccc3)c(-c3ccc(F)s3)c2)OC1(C)C |
| InChI | InChI=1S/C28H33FO3S/c1-27(2)28(3,4)32-26(31-27)21-14-15-23(22(19-21)24-16-17-25(29)33-24)30-18-10-6-9-13-20-11-7-5-8-12-20/h5,7-8,11-12,14-17,19,26H,6,9-10,13,18H2,1-4H3 |
| InChIKey | XBHXPTRDAPNFPV-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|