C17H15ClN2O4S — CID 67237512
[5-(5-chlorothiophen-2-yl)-4-ethyl-1-(4-methoxyphenyl)pyrazol-3-yl] hydrogen carbonate (PubChem CID 67237512) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is [5-(5-chlorothiophen-2-yl)-4-ethyl-1-(4-methoxyphenyl)pyrazol-3-yl] hydrogen carbonate.
| Compound Name | [5-(5-chlorothiophen-2-yl)-4-ethyl-1-(4-methoxyphenyl)pyrazol-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67237512 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | [5-(5-chlorothiophen-2-yl)-4-ethyl-1-(4-methoxyphenyl)pyrazol-3-yl] hydrogen carbonate |
| SMILES | CCc1c(OC(=O)O)nn(-c2ccc(OC)cc2)c1-c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H15ClN2O4S/c1-3-12-15(13-8-9-14(18)25-13)20(19-16(12)24-17(21)22)10-4-6-11(23-2)7-5-10/h4-9H,3H2,1-2H3,(H,21,22) |
| InChIKey | KNGDKCHVIDRZSG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |