About (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate
(3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate (PubChem CID 67237810) has the molecular formula C20H21Cl2NO4
and a molecular weight of 410.30 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate |
| PubChem CID | 67237810 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)c(Cl)c1)N1CCC(COc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C20H21Cl2NO4/c21-18-6-1-15(11-19(18)22)13-27-20(25)23-9-7-14(8-10-23)12-26-17-4-2-16(24)3-5-17/h1-6,11,14,24H,7-10,12-13H2 |
| InChIKey | VTEGKLUTMGHSFJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate?
The IUPAC name of (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate (CID 67237810) is (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate.
What is the SMILES notation for (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate?
The canonical SMILES for (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate is O=C(OCc1ccc(Cl)c(Cl)c1)N1CCC(COc2ccc(O)cc2)CC1.
What is the InChIKey of (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate?
The InChIKey is VTEGKLUTMGHSFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2NO4/c21-18-6-1-15(11-19(18)22)13-27-20(25)23-9-7-14(8-10-23)12-26-17-4-2-16(24)3-5-17/h1-6,11,14,24H,7-10,12-13H2.
What are the key properties of (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate?
(3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate has a molecular weight of 410.30 g/mol, XLogP of 5.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)methyl 4-[(4-hydroxyphenoxy)methyl]piperidine-1-carboxylate is sourced from PubChem (CID 67237810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).