C32H36N2O6S — CID 67237983
tert-butyl N-[4-[2-[2-methoxy-4-[2-(4-morpholin-4-ylsulfonylphenyl)ethenyl]phenyl]ethenyl]phenyl]carbamate (PubChem CID 67237983) has the molecular formula C32H36N2O6S and a molecular weight of 576.72 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[2-methoxy-4-[2-(4-morpholin-4-ylsulfonylphenyl)ethenyl]phenyl]ethenyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[2-methoxy-4-[2-(4-morpholin-4-ylsulfonylphenyl)ethenyl]phenyl]ethenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67237983 |
| Molecular Formula | C32H36N2O6S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | tert-butyl N-[4-[2-[2-methoxy-4-[2-(4-morpholin-4-ylsulfonylphenyl)ethenyl]phenyl]ethenyl]phenyl]carbamate |
| SMILES | COc1cc(C=Cc2ccc(S(=O)(=O)N3CCOCC3)cc2)ccc1C=Cc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C32H36N2O6S/c1-32(2,3)40-31(35)33-28-15-9-25(10-16-28)7-13-27-14-8-26(23-30(27)38-4)6-5-24-11-17-29(18-12-24)41(36,37)34-19-21-39-22-20-34/h5-18,23H,19-22H2,1-4H3,(H,33,35) |
| InChIKey | HKQFGJYXERUSKN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|