C10H6ClN3O3S — CID 672387
2-chloro-4-nitro-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 672387) has the molecular formula C10H6ClN3O3S and a molecular weight of 283.70 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-chloro-4-nitro-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 672387 |
| Molecular Formula | C10H6ClN3O3S |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 2-chloro-4-nitro-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H6ClN3O3S/c11-8-5-6(14(16)17)1-2-7(8)9(15)13-10-12-3-4-18-10/h1-5H,(H,12,13,15) |
| InChIKey | SSOBTHGPSUDJKP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|