C17H25N3O3 — CID 67241490
ethyl 3-[(2-piperidin-4-ylacetyl)amino]-3-pyridin-2-ylpropanoate (PubChem CID 67241490) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is ethyl 3-[(2-piperidin-4-ylacetyl)amino]-3-pyridin-2-ylpropanoate.
| Compound Name | ethyl 3-[(2-piperidin-4-ylacetyl)amino]-3-pyridin-2-ylpropanoate |
|---|---|
| PubChem CID | 67241490 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | ethyl 3-[(2-piperidin-4-ylacetyl)amino]-3-pyridin-2-ylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)CC1CCNCC1)c1ccccn1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-23-17(22)12-15(14-5-3-4-8-19-14)20-16(21)11-13-6-9-18-10-7-13/h3-5,8,13,15,18H,2,6-7,9-12H2,1H3,(H,20,21) |
| InChIKey | BWZPZQVSRAUPRK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |