C8H11NO3 — CID 67244115
4-prop-2-enyl-1,4-oxazepane-5,7-dione (PubChem CID 67244115) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-prop-2-enyl-1,4-oxazepane-5,7-dione.
| Compound Name | 4-prop-2-enyl-1,4-oxazepane-5,7-dione |
|---|---|
| PubChem CID | 67244115 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-prop-2-enyl-1,4-oxazepane-5,7-dione |
| SMILES | C=CCN1CCOC(=O)CC1=O |
| InChI | InChI=1S/C8H11NO3/c1-2-3-9-4-5-12-8(11)6-7(9)10/h2H,1,3-6H2 |
| InChIKey | AHEOEJIQYBRIKU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|