C15H15N3O4 — CID 6724452
(2S)-3-hydroxy-N-(1,2-oxazol-3-yl)-2-(3-phenylprop-2-enoylamino)propanamide (PubChem CID 6724452) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is (2S)-3-hydroxy-N-(1,2-oxazol-3-yl)-2-(3-phenylprop-2-enoylamino)propanamide.
| Compound Name | (2S)-3-hydroxy-N-(1,2-oxazol-3-yl)-2-(3-phenylprop-2-enoylamino)propanamide |
|---|---|
| PubChem CID | 6724452 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (2S)-3-hydroxy-N-(1,2-oxazol-3-yl)-2-(3-phenylprop-2-enoylamino)propanamide |
| SMILES | O=C(C=Cc1ccccc1)N[C@@H](CO)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C15H15N3O4/c19-10-12(15(21)17-13-8-9-22-18-13)16-14(20)7-6-11-4-2-1-3-5-11/h1-9,12,19H,10H2,(H,16,20)(H,17,18,21)/t12-/m0/s1 |
| InChIKey | UYZFDCASSKHJDA-LBPRGKRZSA-N |
| XLogP | 0.80 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|