C15H10F5N3O4 — CID 6724492
(2S)-3-hydroxy-N-(1,2-oxazol-3-yl)-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide (PubChem CID 6724492) has the molecular formula C15H10F5N3O4 and a molecular weight of 391.25 g/mol. Its IUPAC name is (2S)-3-hydroxy-N-(1,2-oxazol-3-yl)-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide.
| Compound Name | (2S)-3-hydroxy-N-(1,2-oxazol-3-yl)-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide |
|---|---|
| PubChem CID | 6724492 |
| Molecular Formula | C15H10F5N3O4 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | (2S)-3-hydroxy-N-(1,2-oxazol-3-yl)-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide |
| SMILES | O=C(C=Cc1c(F)c(F)c(F)c(F)c1F)N[C@@H](CO)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C15H10F5N3O4/c16-10-6(11(17)13(19)14(20)12(10)18)1-2-9(25)21-7(5-24)15(26)22-8-3-4-27-23-8/h1-4,7,24H,5H2,(H,21,25)(H,22,23,26)/t7-/m0/s1 |
| InChIKey | SYTJKDNTEXMHQZ-ZETCQYMHSA-N |
| XLogP | 1.50 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|