C19H14F6N2O3 — CID 4180033
N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide (PubChem CID 4180033) has the molecular formula C19H14F6N2O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide |
|---|---|
| PubChem CID | 4180033 |
| Molecular Formula | C19H14F6N2O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide |
| SMILES | O=C(C=Cc1c(F)c(F)c(F)c(F)c1F)NC(CO)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H14F6N2O3/c20-10-3-1-9(2-4-10)7-26-19(30)12(8-28)27-13(29)6-5-11-14(21)16(23)18(25)17(24)15(11)22/h1-6,12,28H,7-8H2,(H,26,30)(H,27,29) |
| InChIKey | NIZXSDFRNMFGAT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|