C25H24F5N3O5 — CID 4290467
benzyl 4-[3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanoyl]-1,4-diazepane-1-carboxylate (PubChem CID 4290467) has the molecular formula C25H24F5N3O5 and a molecular weight of 541.47 g/mol. Its IUPAC name is benzyl 4-[3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl 4-[3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 4290467 |
| Molecular Formula | C25H24F5N3O5 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | benzyl 4-[3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanoyl]-1,4-diazepane-1-carboxylate |
| SMILES | O=C(C=Cc1c(F)c(F)c(F)c(F)c1F)NC(CO)C(=O)N1CCCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H24F5N3O5/c26-19-16(20(27)22(29)23(30)21(19)28)7-8-18(35)31-17(13-34)24(36)32-9-4-10-33(12-11-32)25(37)38-14-15-5-2-1-3-6-15/h1-3,5-8,17,34H,4,9-14H2,(H,31,35) |
| InChIKey | RHKVHEYOXRNBFY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|