C36H37N3O5 — CID 6723000
benzyl 4-[(2S)-3-hydroxy-2-(4-pyren-1-ylbutanoylamino)propanoyl]-1,4-diazepane-1-carboxylate (PubChem CID 6723000) has the molecular formula C36H37N3O5 and a molecular weight of 591.71 g/mol. Its IUPAC name is benzyl 4-[(2S)-3-hydroxy-2-(4-pyren-1-ylbutanoylamino)propanoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl 4-[(2S)-3-hydroxy-2-(4-pyren-1-ylbutanoylamino)propanoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 6723000 |
| Molecular Formula | C36H37N3O5 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | benzyl 4-[(2S)-3-hydroxy-2-(4-pyren-1-ylbutanoylamino)propanoyl]-1,4-diazepane-1-carboxylate |
| SMILES | O=C(CCCc1ccc2ccc3cccc4ccc1c2c34)N[C@@H](CO)C(=O)N1CCCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C36H37N3O5/c40-23-31(35(42)38-19-6-20-39(22-21-38)36(43)44-24-25-7-2-1-3-8-25)37-32(41)12-5-9-26-13-14-29-16-15-27-10-4-11-28-17-18-30(26)34(29)33(27)28/h1-4,7-8,10-11,13-18,31,40H,5-6,9,12,19-24H2,(H,37,41)/t31-/m0/s1 |
| InChIKey | WUDVPCXBTCPLMW-HKBQPEDESA-N |
| XLogP | 5.25 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|