C23H22F5N3O5 — CID 6724406
benzyl 4-[(2S)-3-hydroxy-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]propanoyl]-1,4-diazepane-1-carboxylate (PubChem CID 6724406) has the molecular formula C23H22F5N3O5 and a molecular weight of 515.44 g/mol. Its IUPAC name is benzyl 4-[(2S)-3-hydroxy-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]propanoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl 4-[(2S)-3-hydroxy-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]propanoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 6724406 |
| Molecular Formula | C23H22F5N3O5 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | benzyl 4-[(2S)-3-hydroxy-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]propanoyl]-1,4-diazepane-1-carboxylate |
| SMILES | O=C(N[C@@H](CO)C(=O)N1CCCN(C(=O)OCc2ccccc2)CC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H22F5N3O5/c24-16-15(17(25)19(27)20(28)18(16)26)21(33)29-14(11-32)22(34)30-7-4-8-31(10-9-30)23(35)36-12-13-5-2-1-3-6-13/h1-3,5-6,14,32H,4,7-12H2,(H,29,33)/t14-/m0/s1 |
| InChIKey | OEGAQHZBVWRQBO-AWEZNQCLSA-N |
| XLogP | 2.34 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|