C18H16F5N5O3 — CID 6724410
2,3,4,5,6-pentafluoro-N-[(2S)-3-hydroxy-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]benzamide (PubChem CID 6724410) has the molecular formula C18H16F5N5O3 and a molecular weight of 445.35 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(2S)-3-hydroxy-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(2S)-3-hydroxy-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 6724410 |
| Molecular Formula | C18H16F5N5O3 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(2S)-3-hydroxy-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](CO)C(=O)N1CCN(c2ncccn2)CC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H16F5N5O3/c19-11-10(12(20)14(22)15(23)13(11)21)16(30)26-9(8-29)17(31)27-4-6-28(7-5-27)18-24-2-1-3-25-18/h1-3,9,29H,4-8H2,(H,26,30)/t9-/m0/s1 |
| InChIKey | RMENTOLGFNBQKJ-VIFPVBQESA-N |
| XLogP | 0.61 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|