C24H26N2O3S2 — CID 67246978
1-(benzenesulfonyl)-6-phenyl-N-(1-thiophen-2-ylethyl)piperidine-3-carboxamide (PubChem CID 67246978) has the molecular formula C24H26N2O3S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-phenyl-N-(1-thiophen-2-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-6-phenyl-N-(1-thiophen-2-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67246978 |
| Molecular Formula | C24H26N2O3S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-(benzenesulfonyl)-6-phenyl-N-(1-thiophen-2-ylethyl)piperidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCC(c2ccccc2)N(S(=O)(=O)c2ccccc2)C1)c1cccs1 |
| InChI | InChI=1S/C24H26N2O3S2/c1-18(23-13-8-16-30-23)25-24(27)20-14-15-22(19-9-4-2-5-10-19)26(17-20)31(28,29)21-11-6-3-7-12-21/h2-13,16,18,20,22H,14-15,17H2,1H3,(H,25,27) |
| InChIKey | LDPSUNRADJHQMV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |