C30H32N2O4S — CID 75989747
[1-[1-(benzenesulfonyl)-6-phenylpiperidine-3-carbonyl]piperidin-4-yl]-phenylmethanone (PubChem CID 75989747) has the molecular formula C30H32N2O4S and a molecular weight of 516.66 g/mol. Its IUPAC name is [1-[1-(benzenesulfonyl)-6-phenylpiperidine-3-carbonyl]piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-[1-(benzenesulfonyl)-6-phenylpiperidine-3-carbonyl]piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 75989747 |
| Molecular Formula | C30H32N2O4S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [1-[1-(benzenesulfonyl)-6-phenylpiperidine-3-carbonyl]piperidin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCN(C(=O)C2CCC(c3ccccc3)N(S(=O)(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C30H32N2O4S/c33-29(24-12-6-2-7-13-24)25-18-20-31(21-19-25)30(34)26-16-17-28(23-10-4-1-5-11-23)32(22-26)37(35,36)27-14-8-3-9-15-27/h1-15,25-26,28H,16-22H2 |
| InChIKey | QMXNBIXURRUYMP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |