C27H33N3O5S — CID 67247758
prop-2-enyl N-[1-[1-(benzenesulfonyl)-6-phenylpiperidine-3-carbonyl]piperidin-4-yl]carbamate (PubChem CID 67247758) has the molecular formula C27H33N3O5S and a molecular weight of 511.64 g/mol. Its IUPAC name is prop-2-enyl N-[1-[1-(benzenesulfonyl)-6-phenylpiperidine-3-carbonyl]piperidin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-[1-(benzenesulfonyl)-6-phenylpiperidine-3-carbonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 67247758 |
| Molecular Formula | C27H33N3O5S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | prop-2-enyl N-[1-[1-(benzenesulfonyl)-6-phenylpiperidine-3-carbonyl]piperidin-4-yl]carbamate |
| SMILES | C=CCOC(=O)NC1CCN(C(=O)C2CCC(c3ccccc3)N(S(=O)(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C27H33N3O5S/c1-2-19-35-27(32)28-23-15-17-29(18-16-23)26(31)22-13-14-25(21-9-5-3-6-10-21)30(20-22)36(33,34)24-11-7-4-8-12-24/h2-12,22-23,25H,1,13-20H2,(H,28,32) |
| InChIKey | NQOYAQVBYYCUOS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|