C31H38N2O3 — CID 67250203
1-[3-amino-4-hydroxy-2-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 67250203) has the molecular formula C31H38N2O3 and a molecular weight of 486.66 g/mol. Its IUPAC name is 1-[3-amino-4-hydroxy-2-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1-[3-amino-4-hydroxy-2-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 67250203 |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 1-[3-amino-4-hydroxy-2-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Nc1c(O)ccc(-c2c(O)ccc3c2CCCC3)c1CCc1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C31H38N2O3/c32-31-27(14-10-22-8-12-24(13-9-22)36-21-20-33-18-4-1-5-19-33)26(15-17-29(31)35)30-25-7-3-2-6-23(25)11-16-28(30)34/h8-9,11-13,15-17,34-35H,1-7,10,14,18-21,32H2 |
| InChIKey | KIWCEQVQNJPAMS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|