C32H40N2O3 — CID 69088663
1-[2-amino-4-methoxy-3-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 69088663) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is 1-[2-amino-4-methoxy-3-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1-[2-amino-4-methoxy-3-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 69088663 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 1-[2-amino-4-methoxy-3-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1ccc(-c2c(O)ccc3c2CCCC3)c(N)c1CCc1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C32H40N2O3/c1-36-30-18-16-28(31-26-8-4-3-7-24(26)12-17-29(31)35)32(33)27(30)15-11-23-9-13-25(14-10-23)37-22-21-34-19-5-2-6-20-34/h9-10,12-14,16-18,35H,2-8,11,15,19-22,33H2,1H3 |
| InChIKey | BZXQOEIMMSFDSP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|