About 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid
4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 67256146) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid |
| PubChem CID | 67256146 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(O)C(c2nccs2)C1 |
| InChI | InChI=1S/C10H13NO3S/c12-8-2-1-6(10(13)14)5-7(8)9-11-3-4-15-9/h3-4,6-8,12H,1-2,5H2,(H,13,14) |
| InChIKey | IPLWRVWZQKZVBZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The IUPAC name of 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid (CID 67256146) is 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid is O=C(O)C1CCC(O)C(c2nccs2)C1.
What is the InChIKey of 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The InChIKey is IPLWRVWZQKZVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c12-8-2-1-6(10(13)14)5-7(8)9-11-3-4-15-9/h3-4,6-8,12H,1-2,5H2,(H,13,14).
What are the key properties of 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid has a molecular weight of 227.28 g/mol, XLogP of 1.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 67256146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).