C19H35NO3 — CID 67262789
butyl 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]butanoate (PubChem CID 67262789) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is butyl 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]butanoate.
| Compound Name | butyl 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 67262789 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | butyl 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]butanoate |
| SMILES | CCCCOC(=O)C(CC)NC(=O)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C19H35NO3/c1-6-8-11-23-19(22)17(7-2)20-18(21)16-12-14(5)9-10-15(16)13(3)4/h13-17H,6-12H2,1-5H3,(H,20,21)/t14-,15+,16-,17?/m1/s1 |
| InChIKey | IWBDHUIEICXTOZ-LVYZTWJOSA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|