C19H35NO3 — CID 67262827
butyl (2R)-2-[[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-2-oxoethyl]amino]propanoate (PubChem CID 67262827) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is butyl (2R)-2-[[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-2-oxoethyl]amino]propanoate.
| Compound Name | butyl (2R)-2-[[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-2-oxoethyl]amino]propanoate |
|---|---|
| PubChem CID | 67262827 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | butyl (2R)-2-[[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-2-oxoethyl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@@H](C)NCC(=O)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C19H35NO3/c1-6-7-10-23-19(22)15(5)20-12-18(21)17-11-14(4)8-9-16(17)13(2)3/h13-17,20H,6-12H2,1-5H3/t14-,15-,16+,17-/m1/s1 |
| InChIKey | VJSJAUPHLDDUFD-WCXIOVBPSA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|