C17H31AsO3 — CID 173436391
propyl (2R)-2-[(5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]arsanylpropanoate (PubChem CID 173436391) has the molecular formula C17H31AsO3 and a molecular weight of 358.35 g/mol. Its IUPAC name is propyl (2R)-2-[(5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]arsanylpropanoate.
| Compound Name | propyl (2R)-2-[(5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]arsanylpropanoate |
|---|---|
| PubChem CID | 173436391 |
| Molecular Formula | C17H31AsO3 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | propyl (2R)-2-[(5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]arsanylpropanoate |
| SMILES | CCCOC(=O)[C@@H](C)[AsH]C(=O)C1C[C@H](C)CCC1C(C)C |
| InChI | InChI=1S/C17H31AsO3/c1-6-9-21-17(20)13(5)18-16(19)15-10-12(4)7-8-14(15)11(2)3/h11-15,18H,6-10H2,1-5H3/t12-,13-,14?,15?/m1/s1 |
| InChIKey | OCIXTLOMJMEUJL-LMRVLLHPSA-N |
| XLogP | 3.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|