C21H28N2O8 — CID 67262987
1-O-tert-butyl 2-O-methyl (2S,4S)-4-[3-methoxycarbonyl-5-(methylcarbamoyl)phenoxy]pyrrolidine-1,2-dicarboxylate (PubChem CID 67262987) has the molecular formula C21H28N2O8 and a molecular weight of 436.46 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[3-methoxycarbonyl-5-(methylcarbamoyl)phenoxy]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[3-methoxycarbonyl-5-(methylcarbamoyl)phenoxy]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67262987 |
| Molecular Formula | C21H28N2O8 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[3-methoxycarbonyl-5-(methylcarbamoyl)phenoxy]pyrrolidine-1,2-dicarboxylate |
| SMILES | CNC(=O)c1cc(O[C@H]2C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H28N2O8/c1-21(2,3)31-20(27)23-11-15(10-16(23)19(26)29-6)30-14-8-12(17(24)22-4)7-13(9-14)18(25)28-5/h7-9,15-16H,10-11H2,1-6H3,(H,22,24)/t15-,16-/m0/s1 |
| InChIKey | VXDIXXULVNKXDD-HOTGVXAUSA-N |
| XLogP | 1.76 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|