C26H26F2N2O2S2 — CID 67263585
2-[[2-[benzyl(methyl)amino]-3-(3,4-difluorophenyl)propyl]-sulfinoamino]-3-methyl-1-benzothiophene (PubChem CID 67263585) has the molecular formula C26H26F2N2O2S2 and a molecular weight of 500.64 g/mol. Its IUPAC name is 2-[[2-[benzyl(methyl)amino]-3-(3,4-difluorophenyl)propyl]-sulfinoamino]-3-methyl-1-benzothiophene.
| Compound Name | 2-[[2-[benzyl(methyl)amino]-3-(3,4-difluorophenyl)propyl]-sulfinoamino]-3-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 67263585 |
| Molecular Formula | C26H26F2N2O2S2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 2-[[2-[benzyl(methyl)amino]-3-(3,4-difluorophenyl)propyl]-sulfinoamino]-3-methyl-1-benzothiophene |
| SMILES | Cc1c(N(CC(Cc2ccc(F)c(F)c2)N(C)Cc2ccccc2)S(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C26H26F2N2O2S2/c1-18-22-10-6-7-11-25(22)33-26(18)30(34(31)32)17-21(14-20-12-13-23(27)24(28)15-20)29(2)16-19-8-4-3-5-9-19/h3-13,15,21H,14,16-17H2,1-2H3,(H,31,32) |
| InChIKey | PWNIXZOEHFUFKC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|