C20H20BrF2O2PS — CID 143581504
[1-(3-bromo-1-benzothiophen-2-yl)-2-(3,4-difluorophenyl)ethyl]-diethoxyphosphane (PubChem CID 143581504) has the molecular formula C20H20BrF2O2PS and a molecular weight of 473.32 g/mol. Its IUPAC name is [1-(3-bromo-1-benzothiophen-2-yl)-2-(3,4-difluorophenyl)ethyl]-diethoxyphosphane.
| Compound Name | [1-(3-bromo-1-benzothiophen-2-yl)-2-(3,4-difluorophenyl)ethyl]-diethoxyphosphane |
|---|---|
| PubChem CID | 143581504 |
| Molecular Formula | C20H20BrF2O2PS |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | [1-(3-bromo-1-benzothiophen-2-yl)-2-(3,4-difluorophenyl)ethyl]-diethoxyphosphane |
| SMILES | CCOP(OCC)C(Cc1ccc(F)c(F)c1)c1sc2ccccc2c1Br |
| InChI | InChI=1S/C20H20BrF2O2PS/c1-3-24-26(25-4-2)17(12-13-9-10-15(22)16(23)11-13)20-19(21)14-7-5-6-8-18(14)27-20/h5-11,17H,3-4,12H2,1-2H3 |
| InChIKey | HMAHNMALZVWEEC-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|