C26H31BrF3N2O3S2- — CID 67263668
2-[[2-[bis(2-methylpropyl)amino]-3-[4-(trifluoromethoxy)phenyl]propyl]-sulfinatoamino]-3-bromo-1-benzothiophene (PubChem CID 67263668) has the molecular formula C26H31BrF3N2O3S2- and a molecular weight of 620.58 g/mol. Its IUPAC name is 2-[[2-[bis(2-methylpropyl)amino]-3-[4-(trifluoromethoxy)phenyl]propyl]-sulfinatoamino]-3-bromo-1-benzothiophene.
| Compound Name | 2-[[2-[bis(2-methylpropyl)amino]-3-[4-(trifluoromethoxy)phenyl]propyl]-sulfinatoamino]-3-bromo-1-benzothiophene |
|---|---|
| PubChem CID | 67263668 |
| Molecular Formula | C26H31BrF3N2O3S2- |
| Molecular Weight | 620.58 g/mol |
| Exact Mass | 619.09 |
| IUPAC Name | 2-[[2-[bis(2-methylpropyl)amino]-3-[4-(trifluoromethoxy)phenyl]propyl]-sulfinatoamino]-3-bromo-1-benzothiophene |
| SMILES | CC(C)CN(CC(C)C)C(Cc1ccc(OC(F)(F)F)cc1)CN(c1sc2ccccc2c1Br)S(=O)[O-] |
| InChI | InChI=1S/C26H32BrF3N2O3S2/c1-17(2)14-31(15-18(3)4)20(13-19-9-11-21(12-10-19)35-26(28,29)30)16-32(37(33)34)25-24(27)22-7-5-6-8-23(22)36-25/h5-12,17-18,20H,13-16H2,1-4H3,(H,33,34)/p-1 |
| InChIKey | CEQIWHYIXQIXTH-UHFFFAOYSA-M |
| XLogP | 7.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.58 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|