C23H24F3N2O3S3- — CID 67263726
4-[1-[(3-methyl-1-benzothiophen-2-yl)-sulfinatoamino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]thiomorpholine (PubChem CID 67263726) has the molecular formula C23H24F3N2O3S3- and a molecular weight of 529.65 g/mol. Its IUPAC name is 4-[1-[(3-methyl-1-benzothiophen-2-yl)-sulfinatoamino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]thiomorpholine.
| Compound Name | 4-[1-[(3-methyl-1-benzothiophen-2-yl)-sulfinatoamino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]thiomorpholine |
|---|---|
| PubChem CID | 67263726 |
| Molecular Formula | C23H24F3N2O3S3- |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 4-[1-[(3-methyl-1-benzothiophen-2-yl)-sulfinatoamino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]thiomorpholine |
| SMILES | Cc1c(N(CC(Cc2ccc(OC(F)(F)F)cc2)N2CCSCC2)S(=O)[O-])sc2ccccc12 |
| InChI | InChI=1S/C23H25F3N2O3S3/c1-16-20-4-2-3-5-21(20)33-22(16)28(34(29)30)15-18(27-10-12-32-13-11-27)14-17-6-8-19(9-7-17)31-23(24,25)26/h2-9,18H,10-15H2,1H3,(H,29,30)/p-1 |
| InChIKey | WYHSXCZTGPZGEU-UHFFFAOYSA-M |
| XLogP | 5.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|