C24H22N2O2 — CID 67267345
1-benzyl-5-(2,4-dimethylphenyl)-3-(hydroxymethyl)cinnolin-4-one (PubChem CID 67267345) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-benzyl-5-(2,4-dimethylphenyl)-3-(hydroxymethyl)cinnolin-4-one.
| Compound Name | 1-benzyl-5-(2,4-dimethylphenyl)-3-(hydroxymethyl)cinnolin-4-one |
|---|---|
| PubChem CID | 67267345 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-benzyl-5-(2,4-dimethylphenyl)-3-(hydroxymethyl)cinnolin-4-one |
| SMILES | Cc1ccc(-c2cccc3c2c(=O)c(CO)nn3Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H22N2O2/c1-16-11-12-19(17(2)13-16)20-9-6-10-22-23(20)24(28)21(15-27)25-26(22)14-18-7-4-3-5-8-18/h3-13,27H,14-15H2,1-2H3 |
| InChIKey | PJWNXHCCXVAERE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |